C19H17ClN6O2 — CID 67552525
N-[4-chloro-2-(2H-tetrazol-5-yl)phenyl]-1-(2-methoxyethyl)indole-2-carboxamide (PubChem CID 67552525) has the molecular formula C19H17ClN6O2 and a molecular weight of 396.84 g/mol. Its IUPAC name is N-[4-chloro-2-(2H-tetrazol-5-yl)phenyl]-1-(2-methoxyethyl)indole-2-carboxamide.
| Compound Name | N-[4-chloro-2-(2H-tetrazol-5-yl)phenyl]-1-(2-methoxyethyl)indole-2-carboxamide |
|---|---|
| PubChem CID | 67552525 |
| Molecular Formula | C19H17ClN6O2 |
| Molecular Weight | 396.84 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | N-[4-chloro-2-(2H-tetrazol-5-yl)phenyl]-1-(2-methoxyethyl)indole-2-carboxamide |
| SMILES | COCCn1c(C(=O)Nc2ccc(Cl)cc2-c2nn[nH]n2)cc2ccccc21 |
| InChI | InChI=1S/C19H17ClN6O2/c1-28-9-8-26-16-5-3-2-4-12(16)10-17(26)19(27)21-15-7-6-13(20)11-14(15)18-22-24-25-23-18/h2-7,10-11H,8-9H2,1H3,(H,21,27)(H,22,23,24,25) |
| InChIKey | XCDHHCFVEOVMAT-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 97.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.84 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |