C19H23IN2O — CID 67553986
4-(1-benzylpiperidin-4-yl)-4-iodocyclohexa-2,5-diene-1-carboxamide (PubChem CID 67553986) has the molecular formula C19H23IN2O and a molecular weight of 422.31 g/mol. Its IUPAC name is 4-(1-benzylpiperidin-4-yl)-4-iodocyclohexa-2,5-diene-1-carboxamide.
| Compound Name | 4-(1-benzylpiperidin-4-yl)-4-iodocyclohexa-2,5-diene-1-carboxamide |
|---|---|
| PubChem CID | 67553986 |
| Molecular Formula | C19H23IN2O |
| Molecular Weight | 422.31 g/mol |
| Exact Mass | 422.09 |
| IUPAC Name | 4-(1-benzylpiperidin-4-yl)-4-iodocyclohexa-2,5-diene-1-carboxamide |
| SMILES | NC(=O)C1C=CC(I)(C2CCN(Cc3ccccc3)CC2)C=C1 |
| InChI | InChI=1S/C19H23IN2O/c20-19(10-6-16(7-11-19)18(21)23)17-8-12-22(13-9-17)14-15-4-2-1-3-5-15/h1-7,10-11,16-17H,8-9,12-14H2,(H2,21,23) |
| InChIKey | CIGQPTNBZVNRPF-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.31 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|