C25H17N3O2 — CID 67554041
1,1-bis(2-hydroxyacenaphthylen-5-yl)guanidine (PubChem CID 67554041) has the molecular formula C25H17N3O2 and a molecular weight of 391.43 g/mol. Its IUPAC name is 1,1-bis(2-hydroxyacenaphthylen-5-yl)guanidine.
| Compound Name | 1,1-bis(2-hydroxyacenaphthylen-5-yl)guanidine |
|---|---|
| PubChem CID | 67554041 |
| Molecular Formula | C25H17N3O2 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | 1,1-bis(2-hydroxyacenaphthylen-5-yl)guanidine |
| SMILES | [H]/N=C(\N)N(c1ccc2c3c(cccc13)C=C2O)c1ccc2c3c(cccc13)C=C2O |
| InChI | InChI=1S/C25H17N3O2/c26-25(27)28(19-9-7-17-21(29)11-13-3-1-5-15(19)23(13)17)20-10-8-18-22(30)12-14-4-2-6-16(20)24(14)18/h1-12,29-30H,(H3,26,27) |
| InChIKey | PHSUKAYYKFWHDT-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 93.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|