C27H37Cl2N3O3 — CID 67554540
(1R,3S)-1-(aminomethyl)-3-[1-[3-(2-methyl-1H-indol-3-yl)propyl]piperidin-4-yl]-3,4-dihydro-1H-isochromene-5,6-diol;dihydrochloride (PubChem CID 67554540) has the molecular formula C27H37Cl2N3O3 and a molecular weight of 522.52 g/mol. Its IUPAC name is (1R,3S)-1-(aminomethyl)-3-[1-[3-(2-methyl-1H-indol-3-yl)propyl]piperidin-4-yl]-3,4-dihydro-1H-isochromene-5,6-diol;dihydrochloride.
| Compound Name | (1R,3S)-1-(aminomethyl)-3-[1-[3-(2-methyl-1H-indol-3-yl)propyl]piperidin-4-yl]-3,4-dihydro-1H-isochromene-5,6-diol;dihydrochloride |
|---|---|
| PubChem CID | 67554540 |
| Molecular Formula | C27H37Cl2N3O3 |
| Molecular Weight | 522.52 g/mol |
| Exact Mass | 521.22 |
| IUPAC Name | (1R,3S)-1-(aminomethyl)-3-[1-[3-(2-methyl-1H-indol-3-yl)propyl]piperidin-4-yl]-3,4-dihydro-1H-isochromene-5,6-diol;dihydrochloride |
| SMILES | Cc1[nH]c2ccccc2c1CCCN1CCC([C@@H]2Cc3c(ccc(O)c3O)[C@H](CN)O2)CC1.Cl.Cl |
| InChI | InChI=1S/C27H35N3O3.2ClH/c1-17-19(20-5-2-3-7-23(20)29-17)6-4-12-30-13-10-18(11-14-30)25-15-22-21(26(16-28)33-25)8-9-24(31)27(22)32;;/h2-3,5,7-9,18,25-26,29,31-32H,4,6,10-16,28H2,1H3;2*1H/t25-,26-;;/m0../s1 |
| InChIKey | GTEWBYBJBNDTRP-HWTGJJCHSA-N |
| XLogP | 5.02 |
| TPSA | 94.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.52 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|