C14H17ClF2N2O — CID 67554836
(3S)-2-amino-3-(4-chloro-2-fluorophenyl)-1-[(3S)-3-fluoropyrrolidin-1-yl]butan-1-one (PubChem CID 67554836) has the molecular formula C14H17ClF2N2O and a molecular weight of 302.75 g/mol. Its IUPAC name is (3S)-2-amino-3-(4-chloro-2-fluorophenyl)-1-[(3S)-3-fluoropyrrolidin-1-yl]butan-1-one.
| Compound Name | (3S)-2-amino-3-(4-chloro-2-fluorophenyl)-1-[(3S)-3-fluoropyrrolidin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 67554836 |
| Molecular Formula | C14H17ClF2N2O |
| Molecular Weight | 302.75 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | (3S)-2-amino-3-(4-chloro-2-fluorophenyl)-1-[(3S)-3-fluoropyrrolidin-1-yl]butan-1-one |
| SMILES | C[C@@H](c1ccc(Cl)cc1F)C(N)C(=O)N1CC[C@H](F)C1 |
| InChI | InChI=1S/C14H17ClF2N2O/c1-8(11-3-2-9(15)6-12(11)17)13(18)14(20)19-5-4-10(16)7-19/h2-3,6,8,10,13H,4-5,7,18H2,1H3/t8-,10-,13?/m0/s1 |
| InChIKey | SLUCNYSXWVHVHL-FFVMOWJJSA-N |
| XLogP | 2.48 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.75 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |