C12H12ClFN2O2 — CID 67558631
3-[1-(5-chloro-2-fluorophenyl)ethenylamino]-2-methoxyprop-2-enamide (PubChem CID 67558631) has the molecular formula C12H12ClFN2O2 and a molecular weight of 270.69 g/mol. Its IUPAC name is 3-[1-(5-chloro-2-fluorophenyl)ethenylamino]-2-methoxyprop-2-enamide.
| Compound Name | 3-[1-(5-chloro-2-fluorophenyl)ethenylamino]-2-methoxyprop-2-enamide |
|---|---|
| PubChem CID | 67558631 |
| Molecular Formula | C12H12ClFN2O2 |
| Molecular Weight | 270.69 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | 3-[1-(5-chloro-2-fluorophenyl)ethenylamino]-2-methoxyprop-2-enamide |
| SMILES | C=C(NC=C(OC)C(N)=O)c1cc(Cl)ccc1F |
| InChI | InChI=1S/C12H12ClFN2O2/c1-7(16-6-11(18-2)12(15)17)9-5-8(13)3-4-10(9)14/h3-6,16H,1H2,2H3,(H2,15,17) |
| InChIKey | RMMINEZUYSBBNG-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.69 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|