C23H22N4O2S — CID 67559668
4-[(5-acetamido-4-cyano-3-ethylthiophen-2-yl)methyl]-N-(2-aminophenyl)benzamide (PubChem CID 67559668) has the molecular formula C23H22N4O2S and a molecular weight of 418.52 g/mol. Its IUPAC name is 4-[(5-acetamido-4-cyano-3-ethylthiophen-2-yl)methyl]-N-(2-aminophenyl)benzamide.
| Compound Name | 4-[(5-acetamido-4-cyano-3-ethylthiophen-2-yl)methyl]-N-(2-aminophenyl)benzamide |
|---|---|
| PubChem CID | 67559668 |
| Molecular Formula | C23H22N4O2S |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | 4-[(5-acetamido-4-cyano-3-ethylthiophen-2-yl)methyl]-N-(2-aminophenyl)benzamide |
| SMILES | CCc1c(Cc2ccc(C(=O)Nc3ccccc3N)cc2)sc(NC(C)=O)c1C#N |
| InChI | InChI=1S/C23H22N4O2S/c1-3-17-18(13-24)23(26-14(2)28)30-21(17)12-15-8-10-16(11-9-15)22(29)27-20-7-5-4-6-19(20)25/h4-11H,3,12,25H2,1-2H3,(H,26,28)(H,27,29) |
| InChIKey | ZDASICCEAAJQPE-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 108.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|