C22H20N4O2S — CID 88584048
N-(2-aminophenyl)-4-[[4-cyano-5-(1-oxopropan-2-ylamino)thiophen-2-yl]methyl]benzamide (PubChem CID 88584048) has the molecular formula C22H20N4O2S and a molecular weight of 404.50 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[[4-cyano-5-(1-oxopropan-2-ylamino)thiophen-2-yl]methyl]benzamide.
| Compound Name | N-(2-aminophenyl)-4-[[4-cyano-5-(1-oxopropan-2-ylamino)thiophen-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 88584048 |
| Molecular Formula | C22H20N4O2S |
| Molecular Weight | 404.50 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | N-(2-aminophenyl)-4-[[4-cyano-5-(1-oxopropan-2-ylamino)thiophen-2-yl]methyl]benzamide |
| SMILES | CC(C=O)Nc1sc(Cc2ccc(C(=O)Nc3ccccc3N)cc2)cc1C#N |
| InChI | InChI=1S/C22H20N4O2S/c1-14(13-27)25-22-17(12-23)11-18(29-22)10-15-6-8-16(9-7-15)21(28)26-20-5-3-2-4-19(20)24/h2-9,11,13-14,25H,10,24H2,1H3,(H,26,28) |
| InChIKey | WDLPAZWBTKOZTB-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 108.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.50 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|