C32H40ClN3O5 — CID 67561568
[1-(4-chlorobenzoyl)-3-[2-[[1-(diethylamino)-1-oxooctan-2-yl]amino]-2-oxoethyl]-2-methylindol-5-yl] acetate (PubChem CID 67561568) has the molecular formula C32H40ClN3O5 and a molecular weight of 582.14 g/mol. Its IUPAC name is [1-(4-chlorobenzoyl)-3-[2-[[1-(diethylamino)-1-oxooctan-2-yl]amino]-2-oxoethyl]-2-methylindol-5-yl] acetate.
| Compound Name | [1-(4-chlorobenzoyl)-3-[2-[[1-(diethylamino)-1-oxooctan-2-yl]amino]-2-oxoethyl]-2-methylindol-5-yl] acetate |
|---|---|
| PubChem CID | 67561568 |
| Molecular Formula | C32H40ClN3O5 |
| Molecular Weight | 582.14 g/mol |
| Exact Mass | 581.27 |
| IUPAC Name | [1-(4-chlorobenzoyl)-3-[2-[[1-(diethylamino)-1-oxooctan-2-yl]amino]-2-oxoethyl]-2-methylindol-5-yl] acetate |
| SMILES | CCCCCCC(NC(=O)Cc1c(C)n(C(=O)c2ccc(Cl)cc2)c2ccc(OC(C)=O)cc12)C(=O)N(CC)CC |
| InChI | InChI=1S/C32H40ClN3O5/c1-6-9-10-11-12-28(32(40)35(7-2)8-3)34-30(38)20-26-21(4)36(31(39)23-13-15-24(33)16-14-23)29-18-17-25(19-27(26)29)41-22(5)37/h13-19,28H,6-12,20H2,1-5H3,(H,34,38) |
| InChIKey | SPQBSBCXSIXPFY-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 97.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.14 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|