C32H43N3O5 — CID 67563555
N-butyl-2-[[2-[5-methoxy-1-(4-methoxybenzoyl)-2-methylindol-3-yl]acetyl]amino]-N-methylheptanamide (PubChem CID 67563555) has the molecular formula C32H43N3O5 and a molecular weight of 549.71 g/mol. Its IUPAC name is N-butyl-2-[[2-[5-methoxy-1-(4-methoxybenzoyl)-2-methylindol-3-yl]acetyl]amino]-N-methylheptanamide.
| Compound Name | N-butyl-2-[[2-[5-methoxy-1-(4-methoxybenzoyl)-2-methylindol-3-yl]acetyl]amino]-N-methylheptanamide |
|---|---|
| PubChem CID | 67563555 |
| Molecular Formula | C32H43N3O5 |
| Molecular Weight | 549.71 g/mol |
| Exact Mass | 549.32 |
| IUPAC Name | N-butyl-2-[[2-[5-methoxy-1-(4-methoxybenzoyl)-2-methylindol-3-yl]acetyl]amino]-N-methylheptanamide |
| SMILES | CCCCCC(NC(=O)Cc1c(C)n(C(=O)c2ccc(OC)cc2)c2ccc(OC)cc12)C(=O)N(C)CCCC |
| InChI | InChI=1S/C32H43N3O5/c1-7-9-11-12-28(32(38)34(4)19-10-8-2)33-30(36)21-26-22(3)35(29-18-17-25(40-6)20-27(26)29)31(37)23-13-15-24(39-5)16-14-23/h13-18,20,28H,7-12,19,21H2,1-6H3,(H,33,36) |
| InChIKey | APOHKSPSUXJOAH-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.71 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|