C29H39N3O3 — CID 67563171
2-[[2-(1-benzyl-5-methoxy-2-methylindol-3-yl)acetyl]amino]-N,N-dimethyloctanamide (PubChem CID 67563171) has the molecular formula C29H39N3O3 and a molecular weight of 477.65 g/mol. Its IUPAC name is 2-[[2-(1-benzyl-5-methoxy-2-methylindol-3-yl)acetyl]amino]-N,N-dimethyloctanamide.
| Compound Name | 2-[[2-(1-benzyl-5-methoxy-2-methylindol-3-yl)acetyl]amino]-N,N-dimethyloctanamide |
|---|---|
| PubChem CID | 67563171 |
| Molecular Formula | C29H39N3O3 |
| Molecular Weight | 477.65 g/mol |
| Exact Mass | 477.30 |
| IUPAC Name | 2-[[2-(1-benzyl-5-methoxy-2-methylindol-3-yl)acetyl]amino]-N,N-dimethyloctanamide |
| SMILES | CCCCCCC(NC(=O)Cc1c(C)n(Cc2ccccc2)c2ccc(OC)cc12)C(=O)N(C)C |
| InChI | InChI=1S/C29H39N3O3/c1-6-7-8-12-15-26(29(34)31(3)4)30-28(33)19-24-21(2)32(20-22-13-10-9-11-14-22)27-17-16-23(35-5)18-25(24)27/h9-11,13-14,16-18,26H,6-8,12,15,19-20H2,1-5H3,(H,30,33) |
| InChIKey | AZYWSGWRKLANAQ-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.65 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|