C32H45N3O3 — CID 67562401
2-acetamido-2-(1-benzyl-5-methoxy-2-methylindol-3-yl)-N-butyl-N-methyloctanamide (PubChem CID 67562401) has the molecular formula C32H45N3O3 and a molecular weight of 519.73 g/mol. Its IUPAC name is 2-acetamido-2-(1-benzyl-5-methoxy-2-methylindol-3-yl)-N-butyl-N-methyloctanamide.
| Compound Name | 2-acetamido-2-(1-benzyl-5-methoxy-2-methylindol-3-yl)-N-butyl-N-methyloctanamide |
|---|---|
| PubChem CID | 67562401 |
| Molecular Formula | C32H45N3O3 |
| Molecular Weight | 519.73 g/mol |
| Exact Mass | 519.35 |
| IUPAC Name | 2-acetamido-2-(1-benzyl-5-methoxy-2-methylindol-3-yl)-N-butyl-N-methyloctanamide |
| SMILES | CCCCCCC(NC(C)=O)(C(=O)N(C)CCCC)c1c(C)n(Cc2ccccc2)c2ccc(OC)cc12 |
| InChI | InChI=1S/C32H45N3O3/c1-7-9-11-15-20-32(33-25(4)36,31(37)34(5)21-10-8-2)30-24(3)35(23-26-16-13-12-14-17-26)29-19-18-27(38-6)22-28(29)30/h12-14,16-19,22H,7-11,15,20-21,23H2,1-6H3,(H,33,36) |
| InChIKey | ANPJEONSINJYNM-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.73 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|