C33H47N3O3 — CID 67561826
2-acetamido-N-butyl-2-[5-methoxy-2-methyl-1-(3-phenylpropyl)indol-3-yl]-N-methylheptanamide (PubChem CID 67561826) has the molecular formula C33H47N3O3 and a molecular weight of 533.76 g/mol. Its IUPAC name is 2-acetamido-N-butyl-2-[5-methoxy-2-methyl-1-(3-phenylpropyl)indol-3-yl]-N-methylheptanamide.
| Compound Name | 2-acetamido-N-butyl-2-[5-methoxy-2-methyl-1-(3-phenylpropyl)indol-3-yl]-N-methylheptanamide |
|---|---|
| PubChem CID | 67561826 |
| Molecular Formula | C33H47N3O3 |
| Molecular Weight | 533.76 g/mol |
| Exact Mass | 533.36 |
| IUPAC Name | 2-acetamido-N-butyl-2-[5-methoxy-2-methyl-1-(3-phenylpropyl)indol-3-yl]-N-methylheptanamide |
| SMILES | CCCCCC(NC(C)=O)(C(=O)N(C)CCCC)c1c(C)n(CCCc2ccccc2)c2ccc(OC)cc12 |
| InChI | InChI=1S/C33H47N3O3/c1-7-9-14-21-33(34-26(4)37,32(38)35(5)22-10-8-2)31-25(3)36(23-15-18-27-16-12-11-13-17-27)30-20-19-28(39-6)24-29(30)31/h11-13,16-17,19-20,24H,7-10,14-15,18,21-23H2,1-6H3,(H,34,37) |
| InChIKey | CYMAASNEGZKNBR-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.76 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|