C34H47N3O4 — CID 67562415
2-acetamido-2-[1-(4-butylbenzoyl)-5-methoxy-2-methylindol-3-yl]-N,N-diethylheptanamide (PubChem CID 67562415) has the molecular formula C34H47N3O4 and a molecular weight of 561.77 g/mol. Its IUPAC name is 2-acetamido-2-[1-(4-butylbenzoyl)-5-methoxy-2-methylindol-3-yl]-N,N-diethylheptanamide.
| Compound Name | 2-acetamido-2-[1-(4-butylbenzoyl)-5-methoxy-2-methylindol-3-yl]-N,N-diethylheptanamide |
|---|---|
| PubChem CID | 67562415 |
| Molecular Formula | C34H47N3O4 |
| Molecular Weight | 561.77 g/mol |
| Exact Mass | 561.36 |
| IUPAC Name | 2-acetamido-2-[1-(4-butylbenzoyl)-5-methoxy-2-methylindol-3-yl]-N,N-diethylheptanamide |
| SMILES | CCCCCC(NC(C)=O)(C(=O)N(CC)CC)c1c(C)n(C(=O)c2ccc(CCCC)cc2)c2ccc(OC)cc12 |
| InChI | InChI=1S/C34H47N3O4/c1-8-12-14-22-34(35-25(6)38,33(40)36(10-3)11-4)31-24(5)37(30-21-20-28(41-7)23-29(30)31)32(39)27-18-16-26(17-19-27)15-13-9-2/h16-21,23H,8-15,22H2,1-7H3,(H,35,38) |
| InChIKey | MDYMJUKHAOUBNL-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.77 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|