C31H40ClN3O4 — CID 67649900
8-[acetyl-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]amino]-N,N-diethyloctanamide (PubChem CID 67649900) has the molecular formula C31H40ClN3O4 and a molecular weight of 554.13 g/mol. Its IUPAC name is 8-[acetyl-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]amino]-N,N-diethyloctanamide.
| Compound Name | 8-[acetyl-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]amino]-N,N-diethyloctanamide |
|---|---|
| PubChem CID | 67649900 |
| Molecular Formula | C31H40ClN3O4 |
| Molecular Weight | 554.13 g/mol |
| Exact Mass | 553.27 |
| IUPAC Name | 8-[acetyl-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]amino]-N,N-diethyloctanamide |
| SMILES | CCN(CC)C(=O)CCCCCCCN(C(C)=O)c1c(C)n(C(=O)c2ccc(Cl)cc2)c2ccc(OC)cc12 |
| InChI | InChI=1S/C31H40ClN3O4/c1-6-33(7-2)29(37)13-11-9-8-10-12-20-34(23(4)36)30-22(3)35(28-19-18-26(39-5)21-27(28)30)31(38)24-14-16-25(32)17-15-24/h14-19,21H,6-13,20H2,1-5H3 |
| InChIKey | CEKBIIKVGMPPSV-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 71.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.13 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|