C23H30N2O2 — CID 21127126
2-[1-(1-benzyl-5-methoxy-2-methylindol-3-yl)ethyl-ethylamino]ethanol (PubChem CID 21127126) has the molecular formula C23H30N2O2 and a molecular weight of 366.51 g/mol. Its IUPAC name is 2-[1-(1-benzyl-5-methoxy-2-methylindol-3-yl)ethyl-ethylamino]ethanol.
| Compound Name | 2-[1-(1-benzyl-5-methoxy-2-methylindol-3-yl)ethyl-ethylamino]ethanol |
|---|---|
| PubChem CID | 21127126 |
| Molecular Formula | C23H30N2O2 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.23 |
| IUPAC Name | 2-[1-(1-benzyl-5-methoxy-2-methylindol-3-yl)ethyl-ethylamino]ethanol |
| SMILES | CCN(CCO)C(C)c1c(C)n(Cc2ccccc2)c2ccc(OC)cc12 |
| InChI | InChI=1S/C23H30N2O2/c1-5-24(13-14-26)17(2)23-18(3)25(16-19-9-7-6-8-10-19)22-12-11-20(27-4)15-21(22)23/h6-12,15,17,26H,5,13-14,16H2,1-4H3 |
| InChIKey | AYSIDWMGPXVRFV-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 37.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|