C25H26O2 — CID 67563916
(2,3-dimethoxy-1,1-diphenylpent-2-enyl)benzene (PubChem CID 67563916) has the molecular formula C25H26O2 and a molecular weight of 358.48 g/mol. Its IUPAC name is (2,3-dimethoxy-1,1-diphenylpent-2-enyl)benzene.
| Compound Name | (2,3-dimethoxy-1,1-diphenylpent-2-enyl)benzene |
|---|---|
| PubChem CID | 67563916 |
| Molecular Formula | C25H26O2 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | (2,3-dimethoxy-1,1-diphenylpent-2-enyl)benzene |
| SMILES | CCC(OC)=C(OC)C(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H26O2/c1-4-23(26-2)24(27-3)25(20-14-8-5-9-15-20,21-16-10-6-11-17-21)22-18-12-7-13-19-22/h5-19H,4H2,1-3H3 |
| InChIKey | VZRNWWFKQPDMDK-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|