C42H34O2 — CID 59782170
(Z)-4-methoxy-1,1,1,5,5,5-hexakis-phenylpent-3-en-2-one (PubChem CID 59782170) has the molecular formula C42H34O2 and a molecular weight of 570.73 g/mol. Its IUPAC name is (Z)-4-methoxy-1,1,1,5,5,5-hexakis-phenylpent-3-en-2-one.
| Compound Name | (Z)-4-methoxy-1,1,1,5,5,5-hexakis-phenylpent-3-en-2-one |
|---|---|
| PubChem CID | 59782170 |
| Molecular Formula | C42H34O2 |
| Molecular Weight | 570.73 g/mol |
| Exact Mass | 570.26 |
| IUPAC Name | (Z)-4-methoxy-1,1,1,5,5,5-hexakis-phenylpent-3-en-2-one |
| SMILES | CO/C(=C\C(=O)C(c1ccccc1)(c1ccccc1)c1ccccc1)C(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C42H34O2/c1-44-40(42(36-26-14-5-15-27-36,37-28-16-6-17-29-37)38-30-18-7-19-31-38)32-39(43)41(33-20-8-2-9-21-33,34-22-10-3-11-23-34)35-24-12-4-13-25-35/h2-32H,1H3/b40-32- |
| InChIKey | ZWBATWCPVOLNRT-KCFYYHDHSA-N |
| XLogP | 9.15 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.73 |
| LogP ≤ 5 | 9.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|