C25H25NO — CID 59782148
(Z)-4-methoxy-N-methyl-1,1,1-triphenylpent-3-en-2-imine (PubChem CID 59782148) has the molecular formula C25H25NO and a molecular weight of 355.48 g/mol. Its IUPAC name is (Z)-4-methoxy-N-methyl-1,1,1-triphenylpent-3-en-2-imine.
| Compound Name | (Z)-4-methoxy-N-methyl-1,1,1-triphenylpent-3-en-2-imine |
|---|---|
| PubChem CID | 59782148 |
| Molecular Formula | C25H25NO |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | (Z)-4-methoxy-N-methyl-1,1,1-triphenylpent-3-en-2-imine |
| SMILES | C/N=C(\C=C(\C)OC)C(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H25NO/c1-20(27-3)19-24(26-2)25(21-13-7-4-8-14-21,22-15-9-5-10-16-22)23-17-11-6-12-18-23/h4-19H,1-3H3/b20-19-,26-24+ |
| InChIKey | CSEHYVZYOFCICR-GYPXDMTISA-N |
| XLogP | 5.64 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|