C24H25AlO — CID 135050435
dimethyl-[(Z)-1,1,1-triphenylbut-2-en-2-yl]oxyalumane (PubChem CID 135050435) has the molecular formula C24H25AlO and a molecular weight of 356.45 g/mol. Its IUPAC name is dimethyl-[(Z)-1,1,1-triphenylbut-2-en-2-yl]oxyalumane.
| Compound Name | dimethyl-[(Z)-1,1,1-triphenylbut-2-en-2-yl]oxyalumane |
|---|---|
| PubChem CID | 135050435 |
| Molecular Formula | C24H25AlO |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | dimethyl-[(Z)-1,1,1-triphenylbut-2-en-2-yl]oxyalumane |
| SMILES | C/C=C(\O[Al](C)C)C(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H20O.2CH3.Al/c1-2-21(23)22(18-12-6-3-7-13-18,19-14-8-4-9-15-19)20-16-10-5-11-17-20;;;/h2-17,23H,1H3;2*1H3;/q;;;+1/p-1/b21-2-;;; |
| InChIKey | TWBBEBAXUJWDTD-JDMXXMTQSA-M |
| XLogP | 6.19 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|