About dimethyl-[(Z)-1,1,1-triphenylbut-2-en-2-yl]oxyalumane
dimethyl-[(Z)-1,1,1-triphenylbut-2-en-2-yl]oxyalumane (PubChem CID 135050435) has the molecular formula C24H25AlO
and a molecular weight of 356.45 g/mol. Its IUPAC name is dimethyl-[(Z)-1,1,1-triphenylbut-2-en-2-yl]oxyalumane.
Molecular Properties
| Compound Name | dimethyl-[(Z)-1,1,1-triphenylbut-2-en-2-yl]oxyalumane |
| PubChem CID | 135050435 |
| Molecular Formula | C24H25AlO |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | dimethyl-[(Z)-1,1,1-triphenylbut-2-en-2-yl]oxyalumane |
| SMILES | C/C=C(\O[Al](C)C)C(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H20O.2CH3.Al/c1-2-21(23)22(18-12-6-3-7-13-18,19-14-8-4-9-15-19)20-16-10-5-11-17-20;;;/h2-17,23H,1H3;2*1H3;/q;;;+1/p-1/b21-2-;;; |
| InChIKey | TWBBEBAXUJWDTD-JDMXXMTQSA-M |
| XLogP | 6.19 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze dimethyl-[(Z)-1,1,1-triphenylbut-2-en-2-yl]oxyalumane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl-[(Z)-1,1,1-triphenylbut-2-en-2-yl]oxyalumane?
The IUPAC name of dimethyl-[(Z)-1,1,1-triphenylbut-2-en-2-yl]oxyalumane (CID 135050435) is dimethyl-[(Z)-1,1,1-triphenylbut-2-en-2-yl]oxyalumane.
What is the SMILES notation for dimethyl-[(Z)-1,1,1-triphenylbut-2-en-2-yl]oxyalumane?
The canonical SMILES for dimethyl-[(Z)-1,1,1-triphenylbut-2-en-2-yl]oxyalumane is C/C=C(\O[Al](C)C)C(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of dimethyl-[(Z)-1,1,1-triphenylbut-2-en-2-yl]oxyalumane?
The InChIKey is TWBBEBAXUJWDTD-JDMXXMTQSA-M. The full InChI is InChI=1S/C22H20O.2CH3.Al/c1-2-21(23)22(18-12-6-3-7-13-18,19-14-8-4-9-15-19)20-16-10-5-11-17-20;;;/h2-17,23H,1H3;2*1H3;/q;;;+1/p-1/b21-2-;;;.
What are the key properties of dimethyl-[(Z)-1,1,1-triphenylbut-2-en-2-yl]oxyalumane?
dimethyl-[(Z)-1,1,1-triphenylbut-2-en-2-yl]oxyalumane has a molecular weight of 356.45 g/mol, XLogP of 6.19, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl-[(Z)-1,1,1-triphenylbut-2-en-2-yl]oxyalumane is sourced from PubChem (CID 135050435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).