About sodium;4-hydroxy-2-propylbenzoate;trihydrate
sodium;4-hydroxy-2-propylbenzoate;trihydrate (PubChem CID 67564094) has the molecular formula C10H17NaO6
and a molecular weight of 256.23 g/mol. Its IUPAC name is sodium;4-hydroxy-2-propylbenzoate;trihydrate.
Molecular Properties
| Compound Name | sodium;4-hydroxy-2-propylbenzoate;trihydrate |
| PubChem CID | 67564094 |
| Molecular Formula | C10H17NaO6 |
| Molecular Weight | 256.23 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | sodium;4-hydroxy-2-propylbenzoate;trihydrate |
| SMILES | CCCc1cc(O)ccc1C(=O)[O-].O.O.O.[Na+] |
| InChI | InChI=1S/C10H12O3.Na.3H2O/c1-2-3-7-6-8(11)4-5-9(7)10(12)13;;;;/h4-6,11H,2-3H2,1H3,(H,12,13);;3*1H2/q;+1;;;/p-1 |
| InChIKey | TURDPOKUFUKJBK-UHFFFAOYSA-M |
| XLogP | -4.76 |
| TPSA | 154.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.23 |
| LogP ≤ 5 | -4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze sodium;4-hydroxy-2-propylbenzoate;trihydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;4-hydroxy-2-propylbenzoate;trihydrate?
The IUPAC name of sodium;4-hydroxy-2-propylbenzoate;trihydrate (CID 67564094) is sodium;4-hydroxy-2-propylbenzoate;trihydrate.
What is the SMILES notation for sodium;4-hydroxy-2-propylbenzoate;trihydrate?
The canonical SMILES for sodium;4-hydroxy-2-propylbenzoate;trihydrate is CCCc1cc(O)ccc1C(=O)[O-].O.O.O.[Na+].
What is the InChIKey of sodium;4-hydroxy-2-propylbenzoate;trihydrate?
The InChIKey is TURDPOKUFUKJBK-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H12O3.Na.3H2O/c1-2-3-7-6-8(11)4-5-9(7)10(12)13;;;;/h4-6,11H,2-3H2,1H3,(H,12,13);;3*1H2/q;+1;;;/p-1.
What are the key properties of sodium;4-hydroxy-2-propylbenzoate;trihydrate?
sodium;4-hydroxy-2-propylbenzoate;trihydrate has a molecular weight of 256.23 g/mol, XLogP of -4.76, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;4-hydroxy-2-propylbenzoate;trihydrate is sourced from PubChem (CID 67564094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).