C22H26O4 — CID 67954843
[4-(4-hydroxyphenyl)cyclohexyl] 4-hydroxy-2-propylbenzoate (PubChem CID 67954843) has the molecular formula C22H26O4 and a molecular weight of 354.45 g/mol. Its IUPAC name is [4-(4-hydroxyphenyl)cyclohexyl] 4-hydroxy-2-propylbenzoate.
| Compound Name | [4-(4-hydroxyphenyl)cyclohexyl] 4-hydroxy-2-propylbenzoate |
|---|---|
| PubChem CID | 67954843 |
| Molecular Formula | C22H26O4 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | [4-(4-hydroxyphenyl)cyclohexyl] 4-hydroxy-2-propylbenzoate |
| SMILES | CCCc1cc(O)ccc1C(=O)OC1CCC(c2ccc(O)cc2)CC1 |
| InChI | InChI=1S/C22H26O4/c1-2-3-17-14-19(24)10-13-21(17)22(25)26-20-11-6-16(7-12-20)15-4-8-18(23)9-5-15/h4-5,8-10,13-14,16,20,23-24H,2-3,6-7,11-12H2,1H3 |
| InChIKey | GUUUTCQQECOYEJ-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |