C22H26FIN2O5 — CID 67564246
2-(4-fluorophenyl)acetamide;(2S)-3-(4-iodophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (PubChem CID 67564246) has the molecular formula C22H26FIN2O5 and a molecular weight of 544.36 g/mol. Its IUPAC name is 2-(4-fluorophenyl)acetamide;(2S)-3-(4-iodophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid.
| Compound Name | 2-(4-fluorophenyl)acetamide;(2S)-3-(4-iodophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
|---|---|
| PubChem CID | 67564246 |
| Molecular Formula | C22H26FIN2O5 |
| Molecular Weight | 544.36 g/mol |
| Exact Mass | 544.09 |
| IUPAC Name | 2-(4-fluorophenyl)acetamide;(2S)-3-(4-iodophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1ccc(I)cc1)C(=O)O.NC(=O)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C14H18INO4.C8H8FNO/c1-14(2,3)20-13(19)16-11(12(17)18)8-9-4-6-10(15)7-5-9;9-7-3-1-6(2-4-7)5-8(10)11/h4-7,11H,8H2,1-3H3,(H,16,19)(H,17,18);1-4H,5H2,(H2,10,11)/t11-;/m0./s1 |
| InChIKey | NKXUIERHXXGRNG-MERQFXBCSA-N |
| XLogP | 3.67 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.36 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|