C16H18ClN3O2S — CID 67564633
N-[[1-(4-aminophenyl)-5-oxopyrrolidin-3-yl]methyl]-5-chloro-2,3-dihydrothiophene-2-carboxamide (PubChem CID 67564633) has the molecular formula C16H18ClN3O2S and a molecular weight of 351.86 g/mol. Its IUPAC name is N-[[1-(4-aminophenyl)-5-oxopyrrolidin-3-yl]methyl]-5-chloro-2,3-dihydrothiophene-2-carboxamide.
| Compound Name | N-[[1-(4-aminophenyl)-5-oxopyrrolidin-3-yl]methyl]-5-chloro-2,3-dihydrothiophene-2-carboxamide |
|---|---|
| PubChem CID | 67564633 |
| Molecular Formula | C16H18ClN3O2S |
| Molecular Weight | 351.86 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | N-[[1-(4-aminophenyl)-5-oxopyrrolidin-3-yl]methyl]-5-chloro-2,3-dihydrothiophene-2-carboxamide |
| SMILES | Nc1ccc(N2CC(CNC(=O)C3CC=C(Cl)S3)CC2=O)cc1 |
| InChI | InChI=1S/C16H18ClN3O2S/c17-14-6-5-13(23-14)16(22)19-8-10-7-15(21)20(9-10)12-3-1-11(18)2-4-12/h1-4,6,10,13H,5,7-9,18H2,(H,19,22) |
| InChIKey | OQYJUIGHNSJOPM-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.86 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|