C16H32N4O2 — CID 67565113
(2S)-2-[(2-aminoacetyl)amino]-N-(2-cyclohexylethyl)-5-(methylamino)pentanamide (PubChem CID 67565113) has the molecular formula C16H32N4O2 and a molecular weight of 312.46 g/mol. Its IUPAC name is (2S)-2-[(2-aminoacetyl)amino]-N-(2-cyclohexylethyl)-5-(methylamino)pentanamide.
| Compound Name | (2S)-2-[(2-aminoacetyl)amino]-N-(2-cyclohexylethyl)-5-(methylamino)pentanamide |
|---|---|
| PubChem CID | 67565113 |
| Molecular Formula | C16H32N4O2 |
| Molecular Weight | 312.46 g/mol |
| Exact Mass | 312.25 |
| IUPAC Name | (2S)-2-[(2-aminoacetyl)amino]-N-(2-cyclohexylethyl)-5-(methylamino)pentanamide |
| SMILES | CNCCC[C@H](NC(=O)CN)C(=O)NCCC1CCCCC1 |
| InChI | InChI=1S/C16H32N4O2/c1-18-10-5-8-14(20-15(21)12-17)16(22)19-11-9-13-6-3-2-4-7-13/h13-14,18H,2-12,17H2,1H3,(H,19,22)(H,20,21)/t14-/m0/s1 |
| InChIKey | OYCFZLYZZPGFAQ-AWEZNQCLSA-N |
| XLogP | 0.52 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.46 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|