C15H29N5O3 — CID 170598169
4-amino-2-[(2-aminoacetyl)amino]-N-(1-amino-3-cyclohexyl-1-oxopropan-2-yl)butanamide (PubChem CID 170598169) has the molecular formula C15H29N5O3 and a molecular weight of 327.43 g/mol. Its IUPAC name is 4-amino-2-[(2-aminoacetyl)amino]-N-(1-amino-3-cyclohexyl-1-oxopropan-2-yl)butanamide.
| Compound Name | 4-amino-2-[(2-aminoacetyl)amino]-N-(1-amino-3-cyclohexyl-1-oxopropan-2-yl)butanamide |
|---|---|
| PubChem CID | 170598169 |
| Molecular Formula | C15H29N5O3 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.23 |
| IUPAC Name | 4-amino-2-[(2-aminoacetyl)amino]-N-(1-amino-3-cyclohexyl-1-oxopropan-2-yl)butanamide |
| SMILES | NCCC(NC(=O)CN)C(=O)NC(CC1CCCCC1)C(N)=O |
| InChI | InChI=1S/C15H29N5O3/c16-7-6-11(19-13(21)9-17)15(23)20-12(14(18)22)8-10-4-2-1-3-5-10/h10-12H,1-9,16-17H2,(H2,18,22)(H,19,21)(H,20,23) |
| InChIKey | DTMQFWQLUHYHGZ-UHFFFAOYSA-N |
| XLogP | -1.28 |
| TPSA | 153.33 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |