C22H43N6O3P — CID 20732764
5-[[amino-(dimethylphosphanylamino)methylidene]amino]-N-(1-amino-1-oxobutan-2-yl)-2-[(3-cyclohexyl-2-methylpropanoyl)amino]pentanamide (PubChem CID 20732764) has the molecular formula C22H43N6O3P and a molecular weight of 470.60 g/mol. Its IUPAC name is 5-[[amino-(dimethylphosphanylamino)methylidene]amino]-N-(1-amino-1-oxobutan-2-yl)-2-[(3-cyclohexyl-2-methylpropanoyl)amino]pentanamide.
| Compound Name | 5-[[amino-(dimethylphosphanylamino)methylidene]amino]-N-(1-amino-1-oxobutan-2-yl)-2-[(3-cyclohexyl-2-methylpropanoyl)amino]pentanamide |
|---|---|
| PubChem CID | 20732764 |
| Molecular Formula | C22H43N6O3P |
| Molecular Weight | 470.60 g/mol |
| Exact Mass | 470.31 |
| IUPAC Name | 5-[[amino-(dimethylphosphanylamino)methylidene]amino]-N-(1-amino-1-oxobutan-2-yl)-2-[(3-cyclohexyl-2-methylpropanoyl)amino]pentanamide |
| SMILES | CCC(NC(=O)C(CCC/N=C(\N)NP(C)C)NC(=O)C(C)CC1CCCCC1)C(N)=O |
| InChI | InChI=1S/C22H43N6O3P/c1-5-17(19(23)29)26-21(31)18(12-9-13-25-22(24)28-32(3)4)27-20(30)15(2)14-16-10-7-6-8-11-16/h15-18H,5-14H2,1-4H3,(H2,23,29)(H,26,31)(H,27,30)(H3,24,25,28) |
| InChIKey | XGXSIGLOVRHQKY-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 151.70 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.60 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|