C15H19NO6 — CID 67565632
2-(1-methoxyethenylamino)acetic acid;3-(4-methoxyphenyl)prop-2-enoic acid (PubChem CID 67565632) has the molecular formula C15H19NO6 and a molecular weight of 309.32 g/mol. Its IUPAC name is 2-(1-methoxyethenylamino)acetic acid;3-(4-methoxyphenyl)prop-2-enoic acid.
| Compound Name | 2-(1-methoxyethenylamino)acetic acid;3-(4-methoxyphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 67565632 |
| Molecular Formula | C15H19NO6 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | 2-(1-methoxyethenylamino)acetic acid;3-(4-methoxyphenyl)prop-2-enoic acid |
| SMILES | C=C(NCC(=O)O)OC.COc1ccc(C=CC(=O)O)cc1 |
| InChI | InChI=1S/C10H10O3.C5H9NO3/c1-13-9-5-2-8(3-6-9)4-7-10(11)12;1-4(9-2)6-3-5(7)8/h2-7H,1H3,(H,11,12);6H,1,3H2,2H3,(H,7,8) |
| InChIKey | QTUYJDNXSAGBPR-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|