C17H32O2 — CID 67566331
(4S,6S)-4-(cyclohexylmethyl)-6-hydroxy-8-methylnonan-2-one (PubChem CID 67566331) has the molecular formula C17H32O2 and a molecular weight of 268.44 g/mol. Its IUPAC name is (4S,6S)-4-(cyclohexylmethyl)-6-hydroxy-8-methylnonan-2-one.
| Compound Name | (4S,6S)-4-(cyclohexylmethyl)-6-hydroxy-8-methylnonan-2-one |
|---|---|
| PubChem CID | 67566331 |
| Molecular Formula | C17H32O2 |
| Molecular Weight | 268.44 g/mol |
| Exact Mass | 268.24 |
| IUPAC Name | (4S,6S)-4-(cyclohexylmethyl)-6-hydroxy-8-methylnonan-2-one |
| SMILES | CC(=O)C[C@@H](CC1CCCCC1)C[C@@H](O)CC(C)C |
| InChI | InChI=1S/C17H32O2/c1-13(2)9-17(19)12-16(10-14(3)18)11-15-7-5-4-6-8-15/h13,15-17,19H,4-12H2,1-3H3/t16-,17-/m0/s1 |
| InChIKey | IUHBGNJMTHHTLX-IRXDYDNUSA-N |
| XLogP | 4.35 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.44 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |