C18H23N3O5 — CID 67569169
2-[1-[4-(4-methanehydrazonoylphenyl)-4-oxobutanoyl]piperidin-4-yl]oxyacetic acid (PubChem CID 67569169) has the molecular formula C18H23N3O5 and a molecular weight of 361.40 g/mol. Its IUPAC name is 2-[1-[4-(4-methanehydrazonoylphenyl)-4-oxobutanoyl]piperidin-4-yl]oxyacetic acid.
| Compound Name | 2-[1-[4-(4-methanehydrazonoylphenyl)-4-oxobutanoyl]piperidin-4-yl]oxyacetic acid |
|---|---|
| PubChem CID | 67569169 |
| Molecular Formula | C18H23N3O5 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | 2-[1-[4-(4-methanehydrazonoylphenyl)-4-oxobutanoyl]piperidin-4-yl]oxyacetic acid |
| SMILES | NN=Cc1ccc(C(=O)CCC(=O)N2CCC(OCC(=O)O)CC2)cc1 |
| InChI | InChI=1S/C18H23N3O5/c19-20-11-13-1-3-14(4-2-13)16(22)5-6-17(23)21-9-7-15(8-10-21)26-12-18(24)25/h1-4,11,15H,5-10,12,19H2,(H,24,25) |
| InChIKey | TTYQAINUOQVNGP-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 122.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|