C20H21Cl2N5 — CID 67571124
4-[2-[2-(3-chloroanilino)ethylamino]-2-(1H-imidazol-5-yl)ethyl]benzonitrile;hydrochloride (PubChem CID 67571124) has the molecular formula C20H21Cl2N5 and a molecular weight of 402.33 g/mol. Its IUPAC name is 4-[2-[2-(3-chloroanilino)ethylamino]-2-(1H-imidazol-5-yl)ethyl]benzonitrile;hydrochloride.
| Compound Name | 4-[2-[2-(3-chloroanilino)ethylamino]-2-(1H-imidazol-5-yl)ethyl]benzonitrile;hydrochloride |
|---|---|
| PubChem CID | 67571124 |
| Molecular Formula | C20H21Cl2N5 |
| Molecular Weight | 402.33 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | 4-[2-[2-(3-chloroanilino)ethylamino]-2-(1H-imidazol-5-yl)ethyl]benzonitrile;hydrochloride |
| SMILES | Cl.N#Cc1ccc(CC(NCCNc2cccc(Cl)c2)c2cnc[nH]2)cc1 |
| InChI | InChI=1S/C20H20ClN5.ClH/c21-17-2-1-3-18(11-17)24-8-9-25-19(20-13-23-14-26-20)10-15-4-6-16(12-22)7-5-15;/h1-7,11,13-14,19,24-25H,8-10H2,(H,23,26);1H |
| InChIKey | PLOWRZVPXIWBPN-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 76.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.33 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|