C19H16Cl2N4O2 — CID 70283922
[2-(4-cyanophenyl)-1-(1H-imidazol-5-yl)ethyl] N-(3-chlorophenyl)carbamate;hydrochloride (PubChem CID 70283922) has the molecular formula C19H16Cl2N4O2 and a molecular weight of 403.27 g/mol. Its IUPAC name is [2-(4-cyanophenyl)-1-(1H-imidazol-5-yl)ethyl] N-(3-chlorophenyl)carbamate;hydrochloride.
| Compound Name | [2-(4-cyanophenyl)-1-(1H-imidazol-5-yl)ethyl] N-(3-chlorophenyl)carbamate;hydrochloride |
|---|---|
| PubChem CID | 70283922 |
| Molecular Formula | C19H16Cl2N4O2 |
| Molecular Weight | 403.27 g/mol |
| Exact Mass | 402.07 |
| IUPAC Name | [2-(4-cyanophenyl)-1-(1H-imidazol-5-yl)ethyl] N-(3-chlorophenyl)carbamate;hydrochloride |
| SMILES | Cl.N#Cc1ccc(CC(OC(=O)Nc2cccc(Cl)c2)c2cnc[nH]2)cc1 |
| InChI | InChI=1S/C19H15ClN4O2.ClH/c20-15-2-1-3-16(9-15)24-19(25)26-18(17-11-22-12-23-17)8-13-4-6-14(10-21)7-5-13;/h1-7,9,11-12,18H,8H2,(H,22,23)(H,24,25);1H |
| InChIKey | FHVPHDYDESVFIK-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 90.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.27 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |