C29H31NO7 — CID 67578258
2-[9-(carbamoyloxymethyl)-9H-fluoren-4-yl]-5-(3,5-dimethoxyphenoxy)-2-methylpentanoic acid (PubChem CID 67578258) has the molecular formula C29H31NO7 and a molecular weight of 505.57 g/mol. Its IUPAC name is 2-[9-(carbamoyloxymethyl)-9H-fluoren-4-yl]-5-(3,5-dimethoxyphenoxy)-2-methylpentanoic acid.
| Compound Name | 2-[9-(carbamoyloxymethyl)-9H-fluoren-4-yl]-5-(3,5-dimethoxyphenoxy)-2-methylpentanoic acid |
|---|---|
| PubChem CID | 67578258 |
| Molecular Formula | C29H31NO7 |
| Molecular Weight | 505.57 g/mol |
| Exact Mass | 505.21 |
| IUPAC Name | 2-[9-(carbamoyloxymethyl)-9H-fluoren-4-yl]-5-(3,5-dimethoxyphenoxy)-2-methylpentanoic acid |
| SMILES | COc1cc(OC)cc(OCCCC(C)(C(=O)O)c2cccc3c2-c2ccccc2C3COC(N)=O)c1 |
| InChI | InChI=1S/C29H31NO7/c1-29(27(31)32,12-7-13-36-20-15-18(34-2)14-19(16-20)35-3)25-11-6-10-23-24(17-37-28(30)33)21-8-4-5-9-22(21)26(23)25/h4-6,8-11,14-16,24H,7,12-13,17H2,1-3H3,(H2,30,33)(H,31,32) |
| InChIKey | RIRMVRGGRBQWQJ-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 117.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.57 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|