C25H30IN5O2 — CID 67578310
1-[[2-[3-(2-amino-1,4-dimethyl-5-oxoimidazol-4-yl)phenyl]-4-iodophenyl]methyl]-3-cyclohexylurea (PubChem CID 67578310) has the molecular formula C25H30IN5O2 and a molecular weight of 559.45 g/mol. Its IUPAC name is 1-[[2-[3-(2-amino-1,4-dimethyl-5-oxoimidazol-4-yl)phenyl]-4-iodophenyl]methyl]-3-cyclohexylurea.
| Compound Name | 1-[[2-[3-(2-amino-1,4-dimethyl-5-oxoimidazol-4-yl)phenyl]-4-iodophenyl]methyl]-3-cyclohexylurea |
|---|---|
| PubChem CID | 67578310 |
| Molecular Formula | C25H30IN5O2 |
| Molecular Weight | 559.45 g/mol |
| Exact Mass | 559.14 |
| IUPAC Name | 1-[[2-[3-(2-amino-1,4-dimethyl-5-oxoimidazol-4-yl)phenyl]-4-iodophenyl]methyl]-3-cyclohexylurea |
| SMILES | CN1C(=O)C(C)(c2cccc(-c3cc(I)ccc3CNC(=O)NC3CCCCC3)c2)N=C1N |
| InChI | InChI=1S/C25H30IN5O2/c1-25(22(32)31(2)23(27)30-25)18-8-6-7-16(13-18)21-14-19(26)12-11-17(21)15-28-24(33)29-20-9-4-3-5-10-20/h6-8,11-14,20H,3-5,9-10,15H2,1-2H3,(H2,27,30)(H2,28,29,33) |
| InChIKey | ZKXIPBBMZDDDRR-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 99.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.45 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|