C26H32IN5O2 — CID 89116093
1-[2-[2-[3-(2-amino-1,4-dimethyl-5-oxoimidazol-4-yl)phenyl]-4-iodophenyl]ethyl]-3-cyclohexylurea (PubChem CID 89116093) has the molecular formula C26H32IN5O2 and a molecular weight of 573.48 g/mol. Its IUPAC name is 1-[2-[2-[3-(2-amino-1,4-dimethyl-5-oxoimidazol-4-yl)phenyl]-4-iodophenyl]ethyl]-3-cyclohexylurea.
| Compound Name | 1-[2-[2-[3-(2-amino-1,4-dimethyl-5-oxoimidazol-4-yl)phenyl]-4-iodophenyl]ethyl]-3-cyclohexylurea |
|---|---|
| PubChem CID | 89116093 |
| Molecular Formula | C26H32IN5O2 |
| Molecular Weight | 573.48 g/mol |
| Exact Mass | 573.16 |
| IUPAC Name | 1-[2-[2-[3-(2-amino-1,4-dimethyl-5-oxoimidazol-4-yl)phenyl]-4-iodophenyl]ethyl]-3-cyclohexylurea |
| SMILES | CN1C(=O)C(C)(c2cccc(-c3cc(I)ccc3CCNC(=O)NC3CCCCC3)c2)N=C1N |
| InChI | InChI=1S/C26H32IN5O2/c1-26(23(33)32(2)24(28)31-26)19-8-6-7-18(15-19)22-16-20(27)12-11-17(22)13-14-29-25(34)30-21-9-4-3-5-10-21/h6-8,11-12,15-16,21H,3-5,9-10,13-14H2,1-2H3,(H2,28,31)(H2,29,30,34) |
| InChIKey | YBLDHGCJNGXHDN-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 99.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.48 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|