C6H11N3 — CID 67578460
2,3,5,6,7,8-hexahydroimidazo[1,2-a]pyrazine (PubChem CID 67578460) has the molecular formula C6H11N3 and a molecular weight of 125.17 g/mol. Its IUPAC name is 2,3,5,6,7,8-hexahydroimidazo[1,2-a]pyrazine.
| Compound Name | 2,3,5,6,7,8-hexahydroimidazo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 67578460 |
| Molecular Formula | C6H11N3 |
| Molecular Weight | 125.17 g/mol |
| Exact Mass | 125.10 |
| IUPAC Name | 2,3,5,6,7,8-hexahydroimidazo[1,2-a]pyrazine |
| SMILES | C1CN2CCNCC2=N1 |
| InChI | InChI=1S/C6H11N3/c1-3-9-4-2-8-6(9)5-7-1/h7H,1-5H2 |
| InChIKey | PTLOCFDFKVNPEW-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.17 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |