C12H22F2N2O — CID 67579433
N,N,1-triethyl-4,4-difluoropiperidine-3-carboxamide (PubChem CID 67579433) has the molecular formula C12H22F2N2O and a molecular weight of 248.32 g/mol. Its IUPAC name is N,N,1-triethyl-4,4-difluoropiperidine-3-carboxamide.
| Compound Name | N,N,1-triethyl-4,4-difluoropiperidine-3-carboxamide |
|---|---|
| PubChem CID | 67579433 |
| Molecular Formula | C12H22F2N2O |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.17 |
| IUPAC Name | N,N,1-triethyl-4,4-difluoropiperidine-3-carboxamide |
| SMILES | CCN1CCC(F)(F)C(C(=O)N(CC)CC)C1 |
| InChI | InChI=1S/C12H22F2N2O/c1-4-15-8-7-12(13,14)10(9-15)11(17)16(5-2)6-3/h10H,4-9H2,1-3H3 |
| InChIKey | AEPKQLRCTOIKII-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |