C11H16N2 — CID 67580177
4-(3,3-dimethylpyrrolidin-1-yl)pyridine (PubChem CID 67580177) has the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. Its IUPAC name is 4-(3,3-dimethylpyrrolidin-1-yl)pyridine.
| Compound Name | 4-(3,3-dimethylpyrrolidin-1-yl)pyridine |
|---|---|
| PubChem CID | 67580177 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | 4-(3,3-dimethylpyrrolidin-1-yl)pyridine |
| SMILES | CC1(C)CCN(c2ccncc2)C1 |
| InChI | InChI=1S/C11H16N2/c1-11(2)5-8-13(9-11)10-3-6-12-7-4-10/h3-4,6-7H,5,8-9H2,1-2H3 |
| InChIKey | IEWNTCYGBNSRHE-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |