C12H19N3 — CID 97181815
(3R)-3-propan-2-yl-1-pyridin-4-ylpyrrolidin-3-amine (PubChem CID 97181815) has the molecular formula C12H19N3 and a molecular weight of 205.31 g/mol. Its IUPAC name is (3R)-3-propan-2-yl-1-pyridin-4-ylpyrrolidin-3-amine.
| Compound Name | (3R)-3-propan-2-yl-1-pyridin-4-ylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 97181815 |
| Molecular Formula | C12H19N3 |
| Molecular Weight | 205.31 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | (3R)-3-propan-2-yl-1-pyridin-4-ylpyrrolidin-3-amine |
| SMILES | CC(C)[C@]1(N)CCN(c2ccncc2)C1 |
| InChI | InChI=1S/C12H19N3/c1-10(2)12(13)5-8-15(9-12)11-3-6-14-7-4-11/h3-4,6-7,10H,5,8-9,13H2,1-2H3/t12-/m0/s1 |
| InChIKey | CPORURNIKHIRQY-LBPRGKRZSA-N |
| XLogP | 1.65 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.31 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |