C15H21N3O — CID 87478699
3-pyridin-4-yl-3,9-diazaspiro[5.5]undecane-9-carbaldehyde (PubChem CID 87478699) has the molecular formula C15H21N3O and a molecular weight of 259.35 g/mol. Its IUPAC name is 3-pyridin-4-yl-3,9-diazaspiro[5.5]undecane-9-carbaldehyde.
| Compound Name | 3-pyridin-4-yl-3,9-diazaspiro[5.5]undecane-9-carbaldehyde |
|---|---|
| PubChem CID | 87478699 |
| Molecular Formula | C15H21N3O |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | 3-pyridin-4-yl-3,9-diazaspiro[5.5]undecane-9-carbaldehyde |
| SMILES | O=CN1CCC2(CC1)CCN(c1ccncc1)CC2 |
| InChI | InChI=1S/C15H21N3O/c19-13-17-9-3-15(4-10-17)5-11-18(12-6-15)14-1-7-16-8-2-14/h1-2,7-8,13H,3-6,9-12H2 |
| InChIKey | FZUYEZWYMVHXAC-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|