C18H26N4O4 — CID 67580502
(2S)-3-[2-[(N'-cyclopropylcarbamimidoyl)amino]phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (PubChem CID 67580502) has the molecular formula C18H26N4O4 and a molecular weight of 362.43 g/mol. Its IUPAC name is (2S)-3-[2-[(N'-cyclopropylcarbamimidoyl)amino]phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid.
| Compound Name | (2S)-3-[2-[(N'-cyclopropylcarbamimidoyl)amino]phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
|---|---|
| PubChem CID | 67580502 |
| Molecular Formula | C18H26N4O4 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | (2S)-3-[2-[(N'-cyclopropylcarbamimidoyl)amino]phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1ccccc1N/C(N)=N/C1CC1)C(=O)O |
| InChI | InChI=1S/C18H26N4O4/c1-18(2,3)26-17(25)22-14(15(23)24)10-11-6-4-5-7-13(11)21-16(19)20-12-8-9-12/h4-7,12,14H,8-10H2,1-3H3,(H,22,25)(H,23,24)(H3,19,20,21)/t14-/m0/s1 |
| InChIKey | ZHQIWRNLCZWHGJ-AWEZNQCLSA-N |
| XLogP | 2.10 |
| TPSA | 126.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|