C24H40O7Si3 — CID 67581700
2-[1-[2-ethyl-4-[3-[methyl-bis(trimethylsilyloxy)silyl]prop-2-enoxy]phenyl]propylidene]propanedioic acid (PubChem CID 67581700) has the molecular formula C24H40O7Si3 and a molecular weight of 524.84 g/mol. Its IUPAC name is 2-[1-[2-ethyl-4-[3-[methyl-bis(trimethylsilyloxy)silyl]prop-2-enoxy]phenyl]propylidene]propanedioic acid.
| Compound Name | 2-[1-[2-ethyl-4-[3-[methyl-bis(trimethylsilyloxy)silyl]prop-2-enoxy]phenyl]propylidene]propanedioic acid |
|---|---|
| PubChem CID | 67581700 |
| Molecular Formula | C24H40O7Si3 |
| Molecular Weight | 524.84 g/mol |
| Exact Mass | 524.21 |
| IUPAC Name | 2-[1-[2-ethyl-4-[3-[methyl-bis(trimethylsilyloxy)silyl]prop-2-enoxy]phenyl]propylidene]propanedioic acid |
| SMILES | CCC(=C(C(=O)O)C(=O)O)c1ccc(OCC=C[Si](C)(O[Si](C)(C)C)O[Si](C)(C)C)cc1CC |
| InChI | InChI=1S/C24H40O7Si3/c1-10-18-17-19(13-14-21(18)20(11-2)22(23(25)26)24(27)28)29-15-12-16-34(9,30-32(3,4)5)31-33(6,7)8/h12-14,16-17H,10-11,15H2,1-9H3,(H,25,26)(H,27,28) |
| InChIKey | UKBYKQKFJVINOF-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.84 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|