C21H25NO5 — CID 67581907
2,5-bis(3,4-dimethoxyphenyl)-4,4-dimethyl-5H-1,3-oxazole (PubChem CID 67581907) has the molecular formula C21H25NO5 and a molecular weight of 371.43 g/mol. Its IUPAC name is 2,5-bis(3,4-dimethoxyphenyl)-4,4-dimethyl-5H-1,3-oxazole.
| Compound Name | 2,5-bis(3,4-dimethoxyphenyl)-4,4-dimethyl-5H-1,3-oxazole |
|---|---|
| PubChem CID | 67581907 |
| Molecular Formula | C21H25NO5 |
| Molecular Weight | 371.43 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | 2,5-bis(3,4-dimethoxyphenyl)-4,4-dimethyl-5H-1,3-oxazole |
| SMILES | COc1ccc(C2=NC(C)(C)C(c3ccc(OC)c(OC)c3)O2)cc1OC |
| InChI | InChI=1S/C21H25NO5/c1-21(2)19(13-7-9-15(23-3)17(11-13)25-5)27-20(22-21)14-8-10-16(24-4)18(12-14)26-6/h7-12,19H,1-6H3 |
| InChIKey | CPWXOYBCUDAVEW-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 58.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.43 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |