C19H24FNO6 — CID 67584301
but-2-enedioic acid;2-[(7-fluoro-2,3-dihydro-1H-inden-4-yl)oxymethyl]-4-methylmorpholine (PubChem CID 67584301) has the molecular formula C19H24FNO6 and a molecular weight of 381.40 g/mol. Its IUPAC name is but-2-enedioic acid;2-[(7-fluoro-2,3-dihydro-1H-inden-4-yl)oxymethyl]-4-methylmorpholine.
| Compound Name | but-2-enedioic acid;2-[(7-fluoro-2,3-dihydro-1H-inden-4-yl)oxymethyl]-4-methylmorpholine |
|---|---|
| PubChem CID | 67584301 |
| Molecular Formula | C19H24FNO6 |
| Molecular Weight | 381.40 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | but-2-enedioic acid;2-[(7-fluoro-2,3-dihydro-1H-inden-4-yl)oxymethyl]-4-methylmorpholine |
| SMILES | CN1CCOC(COc2ccc(F)c3c2CCC3)C1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C15H20FNO2.C4H4O4/c1-17-7-8-18-11(9-17)10-19-15-6-5-14(16)12-3-2-4-13(12)15;5-3(6)1-2-4(7)8/h5-6,11H,2-4,7-10H2,1H3;1-2H,(H,5,6)(H,7,8) |
| InChIKey | CIPYJWYLUXDTMG-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.40 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|