C21H24ClN5O5 — CID 67584315
[3-(diaminomethylideneamino)phenyl] (2S)-3-(3-chlorophenyl)-2-[formamido(propan-2-yloxycarbonyl)amino]propanoate (PubChem CID 67584315) has the molecular formula C21H24ClN5O5 and a molecular weight of 461.91 g/mol. Its IUPAC name is [3-(diaminomethylideneamino)phenyl] (2S)-3-(3-chlorophenyl)-2-[formamido(propan-2-yloxycarbonyl)amino]propanoate.
| Compound Name | [3-(diaminomethylideneamino)phenyl] (2S)-3-(3-chlorophenyl)-2-[formamido(propan-2-yloxycarbonyl)amino]propanoate |
|---|---|
| PubChem CID | 67584315 |
| Molecular Formula | C21H24ClN5O5 |
| Molecular Weight | 461.91 g/mol |
| Exact Mass | 461.15 |
| IUPAC Name | [3-(diaminomethylideneamino)phenyl] (2S)-3-(3-chlorophenyl)-2-[formamido(propan-2-yloxycarbonyl)amino]propanoate |
| SMILES | CC(C)OC(=O)N(NC=O)[C@@H](Cc1cccc(Cl)c1)C(=O)Oc1cccc(N=C(N)N)c1 |
| InChI | InChI=1S/C21H24ClN5O5/c1-13(2)31-21(30)27(25-12-28)18(10-14-5-3-6-15(22)9-14)19(29)32-17-8-4-7-16(11-17)26-20(23)24/h3-9,11-13,18H,10H2,1-2H3,(H,25,28)(H4,23,24,26)/t18-/m0/s1 |
| InChIKey | PHZKLAATZCMUHC-SFHVURJKSA-N |
| XLogP | 2.27 |
| TPSA | 149.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.91 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|