C22H24F2O2 — CID 67584984
2-butyl-4-[(E)-1,2-difluoropent-1-enyl]-3-phenylbenzoic acid (PubChem CID 67584984) has the molecular formula C22H24F2O2 and a molecular weight of 358.43 g/mol. Its IUPAC name is 2-butyl-4-[(E)-1,2-difluoropent-1-enyl]-3-phenylbenzoic acid.
| Compound Name | 2-butyl-4-[(E)-1,2-difluoropent-1-enyl]-3-phenylbenzoic acid |
|---|---|
| PubChem CID | 67584984 |
| Molecular Formula | C22H24F2O2 |
| Molecular Weight | 358.43 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | 2-butyl-4-[(E)-1,2-difluoropent-1-enyl]-3-phenylbenzoic acid |
| SMILES | CCCCc1c(C(=O)O)ccc(/C(F)=C(\F)CCC)c1-c1ccccc1 |
| InChI | InChI=1S/C22H24F2O2/c1-3-5-12-16-17(22(25)26)13-14-18(21(24)19(23)9-4-2)20(16)15-10-7-6-8-11-15/h6-8,10-11,13-14H,3-5,9,12H2,1-2H3,(H,25,26)/b21-19+ |
| InChIKey | PIERHPKWYYAVFW-XUTLUUPISA-N |
| XLogP | 6.80 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.43 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |