C8H17NO — CID 67586028
1,3-diethylpyrrolidin-3-ol (PubChem CID 67586028) has the molecular formula C8H17NO and a molecular weight of 143.23 g/mol. Its IUPAC name is 1,3-diethylpyrrolidin-3-ol.
| Compound Name | 1,3-diethylpyrrolidin-3-ol |
|---|---|
| PubChem CID | 67586028 |
| Molecular Formula | C8H17NO |
| Molecular Weight | 143.23 g/mol |
| Exact Mass | 143.13 |
| IUPAC Name | 1,3-diethylpyrrolidin-3-ol |
| SMILES | CCN1CCC(O)(CC)C1 |
| InChI | InChI=1S/C8H17NO/c1-3-8(10)5-6-9(4-2)7-8/h10H,3-7H2,1-2H3 |
| InChIKey | YJXOLWHRAIMNFC-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.23 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |