C27H35Cl3O4 — CID 67586742
2,2,2-trichloroethyl 2-[(6Z,9Z,12Z)-octadeca-6,9,12-trienoyl]oxybenzoate (PubChem CID 67586742) has the molecular formula C27H35Cl3O4 and a molecular weight of 529.93 g/mol. Its IUPAC name is 2,2,2-trichloroethyl 2-[(6Z,9Z,12Z)-octadeca-6,9,12-trienoyl]oxybenzoate.
| Compound Name | 2,2,2-trichloroethyl 2-[(6Z,9Z,12Z)-octadeca-6,9,12-trienoyl]oxybenzoate |
|---|---|
| PubChem CID | 67586742 |
| Molecular Formula | C27H35Cl3O4 |
| Molecular Weight | 529.93 g/mol |
| Exact Mass | 528.16 |
| IUPAC Name | 2,2,2-trichloroethyl 2-[(6Z,9Z,12Z)-octadeca-6,9,12-trienoyl]oxybenzoate |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\CCCCC(=O)Oc1ccccc1C(=O)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C27H35Cl3O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-21-25(31)34-24-20-18-17-19-23(24)26(32)33-22-27(28,29)30/h6-7,9-10,12-13,17-20H,2-5,8,11,14-16,21-22H2,1H3/b7-6-,10-9-,13-12- |
| InChIKey | NODIELVFNMUIJY-QNEBEIHSSA-N |
| XLogP | 8.71 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.93 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|