C28H38O3S — CID 173278010
icosa-5,8,11,14-tetraenoyl 2-methylsulfanylbenzoate (PubChem CID 173278010) has the molecular formula C28H38O3S and a molecular weight of 454.68 g/mol. Its IUPAC name is icosa-5,8,11,14-tetraenoyl 2-methylsulfanylbenzoate.
| Compound Name | icosa-5,8,11,14-tetraenoyl 2-methylsulfanylbenzoate |
|---|---|
| PubChem CID | 173278010 |
| Molecular Formula | C28H38O3S |
| Molecular Weight | 454.68 g/mol |
| Exact Mass | 454.25 |
| IUPAC Name | icosa-5,8,11,14-tetraenoyl 2-methylsulfanylbenzoate |
| SMILES | CCCCCC=CCC=CCC=CCC=CCCCC(=O)OC(=O)c1ccccc1SC |
| InChI | InChI=1S/C28H38O3S/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-24-27(29)31-28(30)25-22-20-21-23-26(25)32-2/h7-8,10-11,13-14,16-17,20-23H,3-6,9,12,15,18-19,24H2,1-2H3 |
| InChIKey | SDHZDXDZUMZWQZ-UHFFFAOYSA-N |
| XLogP | 8.24 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.68 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|