C30H47N5O7 — CID 67588463
tert-butyl N-[(2S)-4-amino-1-[[(4S,5S,7R)-8-[[(2S)-1-(benzylamino)-3-methyl-1-oxobutan-2-yl]amino]-5-hydroxy-7-methyl-8-oxooct-1-en-4-yl]amino]-1,4-dioxobutan-2-yl]carbamate (PubChem CID 67588463) has the molecular formula C30H47N5O7 and a molecular weight of 589.73 g/mol. Its IUPAC name is tert-butyl N-[(2S)-4-amino-1-[[(4S,5S,7R)-8-[[(2S)-1-(benzylamino)-3-methyl-1-oxobutan-2-yl]amino]-5-hydroxy-7-methyl-8-oxooct-1-en-4-yl]amino]-1,4-dioxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-4-amino-1-[[(4S,5S,7R)-8-[[(2S)-1-(benzylamino)-3-methyl-1-oxobutan-2-yl]amino]-5-hydroxy-7-methyl-8-oxooct-1-en-4-yl]amino]-1,4-dioxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 67588463 |
| Molecular Formula | C30H47N5O7 |
| Molecular Weight | 589.73 g/mol |
| Exact Mass | 589.35 |
| IUPAC Name | tert-butyl N-[(2S)-4-amino-1-[[(4S,5S,7R)-8-[[(2S)-1-(benzylamino)-3-methyl-1-oxobutan-2-yl]amino]-5-hydroxy-7-methyl-8-oxooct-1-en-4-yl]amino]-1,4-dioxobutan-2-yl]carbamate |
| SMILES | C=CC[C@H](NC(=O)[C@H](CC(N)=O)NC(=O)OC(C)(C)C)[C@@H](O)C[C@@H](C)C(=O)N[C@H](C(=O)NCc1ccccc1)C(C)C |
| InChI | InChI=1S/C30H47N5O7/c1-8-12-21(33-27(39)22(16-24(31)37)34-29(41)42-30(5,6)7)23(36)15-19(4)26(38)35-25(18(2)3)28(40)32-17-20-13-10-9-11-14-20/h8-11,13-14,18-19,21-23,25,36H,1,12,15-17H2,2-7H3,(H2,31,37)(H,32,40)(H,33,39)(H,34,41)(H,35,38)/t19-,21+,22+,23+,25+/m1/s1 |
| InChIKey | XYCKENBYRDGIFF-MHYAVGLSSA-N |
| XLogP | 1.66 |
| TPSA | 188.95 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.73 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|